CAS 2096998-70-6 is the registry number for Methyl 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 2096998-70-6) is a chemical compound with the molecular formula C13H17BFNO4 and a molecular weight of 281.09 g/mol. IUPAC name: methyl 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: KVPCYEFJVKILSB-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO4 |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | methyl 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | KVPCYEFJVKILSB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2C(=O)OC)F |
Computed by PubChem (NCBI)