CAS 1510828-68-8 appears in our catalog under these names: 2-Fluoro-4-methyl-5-nitrophenylboronic acid, pinacol ester, 95%, (2-FLUORO-4-METHYL-5-NITROPHENYL)BORONIC ACID PINACOL ESTER. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g.
2-(2-fluoro-4-methyl-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1510828-68-8) is a chemical compound with the molecular formula C13H17BFNO4 and a molecular weight of 281.09 g/mol. IUPAC name: 2-(2-fluoro-4-methyl-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VJFYRTJYOVWHNP-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO4 |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 2-(2-fluoro-4-methyl-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VJFYRTJYOVWHNP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)