CAS 1218791-12-8 appears in our catalog under these names: 4-Carbamoyl-3-chlorophenylboronic acid, pinacol ester, 98%, 2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 98%, 4-Carbamoyl-3-chlorophenylboronic acid, pinacol ester, 98%, 98%, 2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g.
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1218791-12-8) is a chemical compound with the molecular formula C13H17BClNO3 and a molecular weight of 281.54 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: BACIYPAZHNHGPX-UHFFFAOYSA-N.
| Molecular formula | C13H17BClNO3 |
|---|---|
| Molecular weight | 281.54 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | BACIYPAZHNHGPX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)N)Cl |
Computed by PubChem (NCBI)