Products 1704081-58-2
CAS 1704081-58-2 is the registry number for (3–Chloro–4–(4–methylpiperidine–1–carbonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-chloro-4-(4-methylpiperidine-1-carbonyl)phenyl]boronic acid (CAS 1704081-58-2) is a chemical compound with the molecular formula C13H17BClNO3 and a molecular weight of 281.54 g/mol. IUPAC name: [3-chloro-4-(4-methylpiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: TZAFAMUSBPGPLV-UHFFFAOYSA-N.
| Molecular formula | C13H17BClNO3 |
|---|---|
| Molecular weight | 281.54 g/mol |
| IUPAC name | [3-chloro-4-(4-methylpiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | TZAFAMUSBPGPLV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N2CCC(CC2)C)Cl)(O)O |
Computed by PubChem (NCBI)