CAS 2828439-43-4 is the registry number for 3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 100mg, 25g, 5g, 1g.
3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2828439-43-4) is a chemical compound with the molecular formula C13H17BClNO3 and a molecular weight of 281.54 g/mol. IUPAC name: 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: CDLLSDLLGCEOQV-UHFFFAOYSA-N.
| Molecular formula | C13H17BClNO3 |
|---|---|
| Molecular weight | 281.54 g/mol |
| IUPAC name | 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | CDLLSDLLGCEOQV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)C(=O)N |
Computed by PubChem (NCBI)