CAS 1219176-41-6 is the registry number for Rac 3-(1,2,4-Triazol-1-yl)-L-alanine-15N,d2. Offered by: TRC. Available pack sizes: 25mg.
2-(15N)azanyl-3-(3,5-dideuterio-1,2,4-triazol-1-yl)propanoic acid (CAS 1219176-41-6) is a chemical compound with the molecular formula C5H8N4O2 and a molecular weight of 159.15 g/mol. IUPAC name: 2-(15N)azanyl-3-(3,5-dideuterio-1,2,4-triazol-1-yl)propanoic acid. InChIKey: XVWFTOJHOHJIMQ-KEGBLKCBSA-N.
| Molecular formula | C5H8N4O2 |
|---|---|
| Molecular weight | 159.15 g/mol |
| IUPAC name | 2-(15N)azanyl-3-(3,5-dideuterio-1,2,4-triazol-1-yl)propanoic acid |
| InChIKey | XVWFTOJHOHJIMQ-KEGBLKCBSA-N |
| SMILES | [2H]C1=NN(C(=N1)[2H])CC(C(=O)O)[15NH2] |
Computed by PubChem (NCBI)