Products 1219426-63-7
CAS 1219426-63-7 appears in our catalog under these names: 4-Benzyl-morpholine-3-carboxylic acid, 95%, 4–Benzylmorpholine–3–carboxylic Acid, 4-Benzylmorpholine-3-carboxylic Acid, 98%, 98%, 4-Benzyl-morpholine-3-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 100mg.
4-benzylmorpholine-3-carboxylic acid (CAS 1219426-63-7) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-benzylmorpholine-3-carboxylic acid. InChIKey: XZVHBJHXLYHSNN-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-benzylmorpholine-3-carboxylic acid |
| InChIKey | XZVHBJHXLYHSNN-UHFFFAOYSA-N |
| SMILES | C1COCC(N1CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)