CAS 1219637-81-6 is the registry number for 5-Chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1219637-81-6) is a chemical compound with the molecular formula C14H17BClNO2 and a molecular weight of 277.55 g/mol. IUPAC name: 5-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: VPQUCRZFTGZNPG-UHFFFAOYSA-N.
| Molecular formula | C14H17BClNO2 |
|---|---|
| Molecular weight | 277.55 g/mol |
| IUPAC name | 5-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | VPQUCRZFTGZNPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2NC=C3)Cl |
Computed by PubChem (NCBI)