Products 1219794-56-5
CAS 1219794-56-5 appears in our catalog under these names: 4-n-Octyl-d17-anisole, 98 atom % D, min 98% Chemical Purity, 4-n-Octyl-anisole-d17, 99.2%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg, 5 mg, 10 mg.
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-4-methoxybenzene (CAS 1219794-56-5) is a chemical compound with the molecular formula C15H24O and a molecular weight of 237.45 g/mol. IUPAC name: 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-4-methoxybenzene. InChIKey: RGDZNCUQBISCLM-RORPREDISA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-4-methoxybenzene |
| InChIKey | RGDZNCUQBISCLM-RORPREDISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)