Products 1219794-94-1

CAS 1219794-94-1 is the registry number for 1-Iodopropane-1,1,3,3,3-d5, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,1,1,3,3-pentadeuterio-3-iodopropane (CAS 1219794-94-1) is a chemical compound with the molecular formula C3H7I and a molecular weight of 175.02 g/mol. IUPAC name: 1,1,1,3,3-pentadeuterio-3-iodopropane. InChIKey: PVWOIHVRPOBWPI-WNWXXORZSA-N.

Identity
Molecular formulaC3H7I
Molecular weight175.02 g/mol
IUPAC name1,1,1,3,3-pentadeuterio-3-iodopropane
InChIKeyPVWOIHVRPOBWPI-WNWXXORZSA-N
SMILES[2H]C([2H])([2H])CC([2H])([2H])I

Computed by PubChem (NCBI)