Products 25493-16-7

CAS 25493-16-7 is the registry number for 1-Iodopropane-3,3,3-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1,1,1-trideuterio-3-iodopropane (CAS 25493-16-7) is a chemical compound with the molecular formula C3H7I and a molecular weight of 173.01 g/mol. IUPAC name: 1,1,1-trideuterio-3-iodopropane. InChIKey: PVWOIHVRPOBWPI-FIBGUPNXSA-N.

Identity
Molecular formulaC3H7I
Molecular weight173.01 g/mol
IUPAC name1,1,1-trideuterio-3-iodopropane
InChIKeyPVWOIHVRPOBWPI-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])CCI

Computed by PubChem (NCBI)