Products 1219804-45-1

CAS 1219804-45-1 is the registry number for 1-Iodopropane-1,1,2,2-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,1,2,2-tetradeuterio-1-iodopropane (CAS 1219804-45-1) is a chemical compound with the molecular formula C3H7I and a molecular weight of 174.02 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-1-iodopropane. InChIKey: PVWOIHVRPOBWPI-RRVWJQJTSA-N.

Identity
Molecular formulaC3H7I
Molecular weight174.02 g/mol
IUPAC name1,1,2,2-tetradeuterio-1-iodopropane
InChIKeyPVWOIHVRPOBWPI-RRVWJQJTSA-N
SMILES[2H]C([2H])(C)C([2H])([2H])I

Computed by PubChem (NCBI)