CAS 1219804-45-1 is the registry number for 1-Iodopropane-1,1,2,2-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,1,2,2-tetradeuterio-1-iodopropane (CAS 1219804-45-1) is a chemical compound with the molecular formula C3H7I and a molecular weight of 174.02 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-1-iodopropane. InChIKey: PVWOIHVRPOBWPI-RRVWJQJTSA-N.
| Molecular formula | C3H7I |
|---|---|
| Molecular weight | 174.02 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-1-iodopropane |
| InChIKey | PVWOIHVRPOBWPI-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(C)C([2H])([2H])I |
Computed by PubChem (NCBI)