CAS 1219795-01-3 appears in our catalog under these names: Sodium Octanoate-8,8,8-d3, 99 atom % D, min 98% Chemical Purity, Sodium Octanoate-8,8,8-d3, >95% (HPLC), Octanoate-d3 (sodium), 99.9%. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 50mg, 5mg, 10 mg, 5 mg.
Sodium 8,8,8-trideuteriooctanoate (CAS 1219795-01-3) is a chemical compound with the molecular formula C8H15NaO2 and a molecular weight of 169.21 g/mol. IUPAC name: sodium 8,8,8-trideuteriooctanoate. InChIKey: BYKRNSHANADUFY-NIIDSAIPSA-M.
| Molecular formula | C8H15NaO2 |
|---|---|
| Molecular weight | 169.21 g/mol |
| IUPAC name | sodium 8,8,8-trideuteriooctanoate |
| InChIKey | BYKRNSHANADUFY-NIIDSAIPSA-M |
| SMILES | [2H]C([2H])([2H])CCCCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)