CAS 2749637-13-4 is the registry number for Sodium 2-(Propyl-1,1-d2)pentanoate-3,3-d2, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.
Sodium 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoate (CAS 2749637-13-4) is a chemical compound with the molecular formula C8H15NaO2 and a molecular weight of 170.22 g/mol. IUPAC name: sodium 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoate. InChIKey: AEQFSUDEHCCHBT-NXMSQKFDSA-M.
| Molecular formula | C8H15NaO2 |
|---|---|
| Molecular weight | 170.22 g/mol |
| IUPAC name | sodium 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoate |
| InChIKey | AEQFSUDEHCCHBT-NXMSQKFDSA-M |
| SMILES | [2H]C([2H])(CC)C(C(=O)[O-])C([2H])([2H])CC.[Na+] |
Computed by PubChem (NCBI)