CAS 201612-61-5 appears in our catalog under these names: Sodium octanoate-1-13c, 95%, Octanoate–13C sodium, SODIUM OCTANOATE-1-13C, 99 ATOM % 13C, Sodium Octanoate-1-13C, ≥99 atom%,≥98%, ≥99 atom%,≥98%, Octanoate-13C (sodium). Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 100mg, 25mg, 50mg, 1 mg.
Sodium (113C)octanoate (CAS 201612-61-5) is a chemical compound with the molecular formula C8H15NaO2 and a molecular weight of 167.19 g/mol. IUPAC name: sodium (113C)octanoate. InChIKey: BYKRNSHANADUFY-IYWRZBIASA-M.
| Molecular formula | C8H15NaO2 |
|---|---|
| Molecular weight | 167.19 g/mol |
| IUPAC name | sodium (113C)octanoate |
| InChIKey | BYKRNSHANADUFY-IYWRZBIASA-M |
| SMILES | CCCCCCC[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)