Products 1189986-72-8
CAS 1189986-72-8 appears in our catalog under these names: Diphenhydramine-d6 Hydrochloride, Diphenhydramine-d6 Hydrochloride (100 μg/mL in Methanol), Diphenhydramine–d6 hydrochloride, Diphenhydramine-d6 (hydrochloride), 99.3%. Offered by: Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5x1ml, 5mg, 1 mg.
2-benzhydryloxy-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride (CAS 1189986-72-8) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 297.9 g/mol. IUPAC name: 2-benzhydryloxy-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride. InChIKey: PCHPORCSPXIHLZ-TXHXQZCNSA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 297.9 g/mol |
| IUPAC name | 2-benzhydryloxy-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride |
| InChIKey | PCHPORCSPXIHLZ-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCOC(C1=CC=CC=C1)C2=CC=CC=C2)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)