CAS 1219795-18-2 appears in our catalog under these names: 3-Nitrobenzyl-d6 Alcohol, 99 atom % D, min 98% Chemical Purity, (3-Nitrophenyl)methanol-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
Dideuterio-(2,3,4,6-tetradeuterio-5-nitrophenyl)methanol (CAS 1219795-18-2) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 159.17 g/mol. IUPAC name: dideuterio-(2,3,4,6-tetradeuterio-5-nitrophenyl)methanol. InChIKey: CWNPOQFCIIFQDM-NVSFMWKBSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 159.17 g/mol |
| IUPAC name | dideuterio-(2,3,4,6-tetradeuterio-5-nitrophenyl)methanol |
| InChIKey | CWNPOQFCIIFQDM-NVSFMWKBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])[2H])C([2H])([2H])O)[2H] |
Computed by PubChem (NCBI)