Products 1219795-29-5

CAS 1219795-29-5 is the registry number for 3,4-Dichlorotoluene-2,5,6-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1,2-dichloro-3,4,6-trideuterio-5-methylbenzene (CAS 1219795-29-5) is a chemical compound with the molecular formula C7H6Cl2 and a molecular weight of 164.04 g/mol. IUPAC name: 1,2-dichloro-3,4,6-trideuterio-5-methylbenzene. InChIKey: WYUIWKFIFOJVKW-NRUYWUNFSA-N.

Identity
Molecular formulaC7H6Cl2
Molecular weight164.04 g/mol
IUPAC name1,2-dichloro-3,4,6-trideuterio-5-methylbenzene
InChIKeyWYUIWKFIFOJVKW-NRUYWUNFSA-N
SMILES[2H]C1=C(C(=C(C(=C1C)[2H])Cl)Cl)[2H]

Computed by PubChem (NCBI)