CAS 1219795-47-7 appears in our catalog under these names: Nisoldipine-d4, >95% (HPLC), (±)-Nisoldipine-d4 (2-nitrodiphenyl-d4), 99 atom % D, min 95% Chemical Purity, Nisoldipine-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 1 mg, 10 mg.
3-O-methyl 5-O-(2-methylpropyl) 2,6-dimethyl-4-(2,3,4,5-tetradeuterio-6-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 1219795-47-7) is a chemical compound with the molecular formula C20H24N2O6 and a molecular weight of 392.4 g/mol. IUPAC name: 3-O-methyl 5-O-(2-methylpropyl) 2,6-dimethyl-4-(2,3,4,5-tetradeuterio-6-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: VKQFCGNPDRICFG-YKVCKAMESA-N.
| Molecular formula | C20H24N2O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 3-O-methyl 5-O-(2-methylpropyl) 2,6-dimethyl-4-(2,3,4,5-tetradeuterio-6-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | VKQFCGNPDRICFG-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2C(=C(NC(=C2C(=O)OCC(C)C)C)C)C(=O)OC)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)