CAS 39562-21-5 appears in our catalog under these names: Nimodipine Impurity 22, Nimodipine Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-O-ethyl 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 39562-21-5) is a chemical compound with the molecular formula C20H24N2O6 and a molecular weight of 388.4 g/mol. IUPAC name: 3-O-ethyl 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: DSZWJKBNTMVXEO-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O6 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 3-O-ethyl 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | DSZWJKBNTMVXEO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC(C)C)C)C |
Computed by PubChem (NCBI)