CAS 2055858-41-6 is the registry number for 1-(tert-Butyl) 4-(1,3-dioxoisoindolin-2-yl) 4-methylpiperidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-(1,3-dioxoisoindol-2-yl) 4-methylpiperidine-1,4-dicarboxylate (CAS 2055858-41-6) is a chemical compound with the molecular formula C20H24N2O6 and a molecular weight of 388.4 g/mol. IUPAC name: 1-O-tert-butyl 4-O-(1,3-dioxoisoindol-2-yl) 4-methylpiperidine-1,4-dicarboxylate. InChIKey: JIGBXRGVMNETMY-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O6 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-(1,3-dioxoisoindol-2-yl) 4-methylpiperidine-1,4-dicarboxylate |
| InChIKey | JIGBXRGVMNETMY-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)