Products 1219799-27-5
CAS 1219799-27-5 appears in our catalog under these names: delta8,9-Dehydroestrone-16,16-d2, 96 atom % D, min 94% Chemical Purity, ∆8,9-Dehydro Estrone-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10 mg, 1 mg.
(13S,14S)-16,16-dideuterio-3-hydroxy-13-methyl-6,7,11,12,14,15-hexahydrocyclopenta[a]phenanthren-17-one (CAS 1219799-27-5) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 270.4 g/mol. IUPAC name: (13S,14S)-16,16-dideuterio-3-hydroxy-13-methyl-6,7,11,12,14,15-hexahydrocyclopenta[a]phenanthren-17-one. InChIKey: OUGSRCWSHMWPQE-JCNCMELZSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (13S,14S)-16,16-dideuterio-3-hydroxy-13-methyl-6,7,11,12,14,15-hexahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | OUGSRCWSHMWPQE-JCNCMELZSA-N |
| SMILES | [2H]C1(C[C@H]2C3=C(CC[C@@]2(C1=O)C)C4=C(CC3)C=C(C=C4)O)[2H] |
Computed by PubChem (NCBI)