CAS 474-87-3 appears in our catalog under these names: Equilin Impurity 12, ∆8,9-Dehydro Estrone, >95% (HPLC), 8,9-Dehydroestrone. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 2mg.
(13S,14S)-3-hydroxy-13-methyl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 474-87-3) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: (13S,14S)-3-hydroxy-13-methyl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: OUGSRCWSHMWPQE-WMZOPIPTSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | (13S,14S)-3-hydroxy-13-methyl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | OUGSRCWSHMWPQE-WMZOPIPTSA-N |
| SMILES | C[C@]12CCC3=C([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)