Products 1219799-33-3
CAS 1219799-33-3 appears in our catalog under these names: Cyclopropyl Methyl Ketone-d8, 98 atom % D, min 98% Chemical Purity, NSC 1940-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 50 mg, 25 mg, 100 mg, 10 mg, 5 mg.
2,2,2-trideuterio-1-(1,2,2,3,3-pentadeuteriocyclopropyl)ethanone (CAS 1219799-33-3) is a chemical compound with the molecular formula C5H8O and a molecular weight of 92.17 g/mol. IUPAC name: 2,2,2-trideuterio-1-(1,2,2,3,3-pentadeuteriocyclopropyl)ethanone. InChIKey: HVCFCNAITDHQFX-IFYAQWLYSA-N.
| Molecular formula | C5H8O |
|---|---|
| Molecular weight | 92.17 g/mol |
| IUPAC name | 2,2,2-trideuterio-1-(1,2,2,3,3-pentadeuteriocyclopropyl)ethanone |
| InChIKey | HVCFCNAITDHQFX-IFYAQWLYSA-N |
| SMILES | [2H]C1(C(C1([2H])C(=O)C([2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)