CAS 350818-63-2 appears in our catalog under these names: Cyclopropyl-2,2,3,3-d4 Methyl Ketone, 99 atom % D, min 98% Chemical Purity, NSC 1940-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 5 mg, 10 mg.
1-(2,2,3,3-tetradeuteriocyclopropyl)ethanone (CAS 350818-63-2) is a chemical compound with the molecular formula C5H8O and a molecular weight of 88.14 g/mol. IUPAC name: 1-(2,2,3,3-tetradeuteriocyclopropyl)ethanone. InChIKey: HVCFCNAITDHQFX-RRVWJQJTSA-N.
| Molecular formula | C5H8O |
|---|---|
| Molecular weight | 88.14 g/mol |
| IUPAC name | 1-(2,2,3,3-tetradeuteriocyclopropyl)ethanone |
| InChIKey | HVCFCNAITDHQFX-RRVWJQJTSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])C(=O)C)[2H] |
Computed by PubChem (NCBI)