Products 95249-93-7
CAS 95249-93-7 appears in our catalog under these names: Cyclopropyl-1-d1 Methyl-d3 Ketone, 98 atom % D, min 98% Chemical Purity, Cyclopropyl-1 Methyl-Ketone-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 1 mg.
2,2,2-trideuterio-1-(1-deuteriocyclopropyl)ethanone (CAS 95249-93-7) is a chemical compound with the molecular formula C5H8O and a molecular weight of 88.14 g/mol. IUPAC name: 2,2,2-trideuterio-1-(1-deuteriocyclopropyl)ethanone. InChIKey: HVCFCNAITDHQFX-DUVDRHTGSA-N.
| Molecular formula | C5H8O |
|---|---|
| Molecular weight | 88.14 g/mol |
| IUPAC name | 2,2,2-trideuterio-1-(1-deuteriocyclopropyl)ethanone |
| InChIKey | HVCFCNAITDHQFX-DUVDRHTGSA-N |
| SMILES | [2H]C1(CC1)C(=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)