Products 1219802-03-5
CAS 1219802-03-5 appears in our catalog under these names: 2,2-Bis(hydroxymethyl-d2)propionic-3,3,3-d3 Acid, 99 atom % D, min 98% Chemical Purity, Dimethylolpropionic acid-d7. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
3,3,3-trideuterio-2,2-bis[dideuterio(hydroxy)methyl]propanoic acid (CAS 1219802-03-5) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 141.17 g/mol. IUPAC name: 3,3,3-trideuterio-2,2-bis[dideuterio(hydroxy)methyl]propanoic acid. InChIKey: PTBDIHRZYDMNKB-NCKGIQLSSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | 3,3,3-trideuterio-2,2-bis[dideuterio(hydroxy)methyl]propanoic acid |
| InChIKey | PTBDIHRZYDMNKB-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])O)C([2H])([2H])O |
Computed by PubChem (NCBI)