Products 1219802-12-6
CAS 1219802-12-6 appears in our catalog under these names: Methyl 2-Hydroxybenzoate-3,4,5,6-d4, Methyl 2-Hydroxybenzoate-3,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, Methyl Salicylate–d4, Methyl Salicylate-d4, 99.8%, D4-Methyl salicylate. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 5mg, 25 mg, 10 mg.
Methyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate (CAS 1219802-12-6) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 156.17 g/mol. IUPAC name: methyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate. InChIKey: OSWPMRLSEDHDFF-QFFDRWTDSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 156.17 g/mol |
| IUPAC name | methyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate |
| InChIKey | OSWPMRLSEDHDFF-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC)O)[2H])[2H] |
Computed by PubChem (NCBI)