Products 1335435-40-9
CAS 1335435-40-9 appears in our catalog under these names: Methyl Salicylate-d3, Methyl Salicylate-d3, >95% (GC), Methyl 2-hydroxybenzoate-d3. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 5 mg, 25 mg.
Methyl 3,4,5-trideuterio-2-hydroxybenzoate (CAS 1335435-40-9) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 155.17 g/mol. IUPAC name: methyl 3,4,5-trideuterio-2-hydroxybenzoate. InChIKey: OSWPMRLSEDHDFF-UHQGOLLYSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | methyl 3,4,5-trideuterio-2-hydroxybenzoate |
| InChIKey | OSWPMRLSEDHDFF-UHQGOLLYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1)C(=O)OC)O)[2H])[2H] |
Computed by PubChem (NCBI)