Products 1219802-46-6
CAS 1219802-46-6 appears in our catalog under these names: 4-(2,4-Dichlorophenoxy-d3)butyric Acid, 98 atom % D, min 98% Chemical Purity, 4-(2,4-Dichlorophenoxy)butanoic acid-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1 mg.
4-(2,4-dichloro-3,5,6-trideuteriophenoxy)butanoic acid (CAS 1219802-46-6) is a chemical compound with the molecular formula C10H10Cl2O3 and a molecular weight of 252.11 g/mol. IUPAC name: 4-(2,4-dichloro-3,5,6-trideuteriophenoxy)butanoic acid. InChIKey: YIVXMZJTEQBPQO-VSWDYIGLSA-N.
| Molecular formula | C10H10Cl2O3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 4-(2,4-dichloro-3,5,6-trideuteriophenoxy)butanoic acid |
| InChIKey | YIVXMZJTEQBPQO-VSWDYIGLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OCCCC(=O)O)Cl)[2H])Cl)[2H] |
Computed by PubChem (NCBI)