Products 2748471-29-4
CAS 2748471-29-4 is the registry number for 2-(Pyridin-2-yl)acetic acid-d4 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetic acid;hydrochloride (CAS 2748471-29-4) is a chemical compound with the molecular formula C7H8ClNO2 and a molecular weight of 177.62 g/mol. IUPAC name: 2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetic acid;hydrochloride. InChIKey: MQVISALTZUNQSK-FOMJDCLLSA-N.
| Molecular formula | C7H8ClNO2 |
|---|---|
| Molecular weight | 177.62 g/mol |
| IUPAC name | 2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetic acid;hydrochloride |
| InChIKey | MQVISALTZUNQSK-FOMJDCLLSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])CC(=O)O)[2H])[2H].Cl |
Computed by PubChem (NCBI)