Products 1219802-84-2
CAS 1219802-84-2 is the registry number for 4-Chlorobenzyl-2,3,5,6-d4 Chloride, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1-chloro-4-(chloromethyl)-2,3,5,6-tetradeuteriobenzene (CAS 1219802-84-2) is a chemical compound with the molecular formula C7H6Cl2 and a molecular weight of 165.05 g/mol. IUPAC name: 1-chloro-4-(chloromethyl)-2,3,5,6-tetradeuteriobenzene. InChIKey: JQZAEUFPPSRDOP-RHQRLBAQSA-N.
| Molecular formula | C7H6Cl2 |
|---|---|
| Molecular weight | 165.05 g/mol |
| IUPAC name | 1-chloro-4-(chloromethyl)-2,3,5,6-tetradeuteriobenzene |
| InChIKey | JQZAEUFPPSRDOP-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCl)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)