CAS 1219803-42-5 appears in our catalog under these names: 4-(4-Chloro-2-methylphenoxy-d3)butyric Acid, >95% (HPLC), 4-(4-Chloro-2-methylphenoxy-d3)butyric Acid, 98 atom % D, min 98% Chemical Purity, 4-(4-Chloro-2-methylphenoxy)butanoic acid-d3, D3-MCPB. Offered by: TRC, CDN, MedChemExpress, HPC Standards. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 500 μg, 5 mg, 1 mg.
4-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)butanoic acid (CAS 1219803-42-5) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 231.69 g/mol. IUPAC name: 4-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)butanoic acid. InChIKey: LLWADFLAOKUBDR-JZLVSFENSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | 4-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)butanoic acid |
| InChIKey | LLWADFLAOKUBDR-JZLVSFENSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OCCCC(=O)O)C)[2H])Cl)[2H] |
Computed by PubChem (NCBI)