Products 1219803-44-7
CAS 1219803-44-7 appears in our catalog under these names: 4-(n-Butylamino-2,2,3,3,4,4,4-d7)benzoic Acid, 95 atom % D, min 98% Chemical Purity, 4-(Butylamino)benzoic acid-d7, 99.67%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg, 5 mg, 10 mg.
4-[deuterio(1,1,2,2,3,3-hexadeuteriobutyl)amino]benzoic acid (CAS 1219803-44-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 200.28 g/mol. IUPAC name: 4-[deuterio(1,1,2,2,3,3-hexadeuteriobutyl)amino]benzoic acid. InChIKey: YCCRFDDXAVMSLM-MJWSLMPXSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 4-[deuterio(1,1,2,2,3,3-hexadeuteriobutyl)amino]benzoic acid |
| InChIKey | YCCRFDDXAVMSLM-MJWSLMPXSA-N |
| SMILES | [2H]C([2H])(C)C([2H])([2H])C([2H])([2H])N([2H])C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)