Products 1219803-57-2
CAS 1219803-57-2 appears in our catalog under these names: Daidzein-d4 (4-hydroxyphenyl-2,3,5,6-d4), 92 atom % D, min 98% Chemical Purity, Daidzein–d4, Daidzein-d4 (4-hydroxyphenyl-2,3,5,6-d4), Daidzein-d4, 98.93%. Offered by: CDN, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 5mg, 500μg, 10mg, 25mg, 50mg.
7-hydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one (CAS 1219803-57-2) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 264.31 g/mol. IUPAC name: 7-hydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one. InChIKey: SLCTVATYOBOWGI-RHQRLBAQSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | 7-hydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| InChIKey | SLCTVATYOBOWGI-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=COC3CC(CCC3C2=O)O)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)