Products 1219803-89-0
CAS 1219803-89-0 appears in our catalog under these names: 3-Methyl-d3-4-nitrophenol-2,5,6-d3, 3-Methyl-d3-4-nitrophenol-2,5,6-d3, 98 atom % D, min 98% Chemical Purity, 2-Methylpiperazine-d6. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 25 mg, 2.5 mg, 5 mg.
2,3,6-trideuterio-4-nitro-5-(trideuteriomethyl)phenol (CAS 1219803-89-0) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 159.17 g/mol. IUPAC name: 2,3,6-trideuterio-4-nitro-5-(trideuteriomethyl)phenol. InChIKey: PIIZYNQECPTVEO-RLTMCGQMSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 159.17 g/mol |
| IUPAC name | 2,3,6-trideuterio-4-nitro-5-(trideuteriomethyl)phenol |
| InChIKey | PIIZYNQECPTVEO-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[N+](=O)[O-])C([2H])([2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)