Products 1219804-00-8
CAS 1219804-00-8 appears in our catalog under these names: 4-Chlorobenzyl-2,3,5,6-d4 Cyanide, 98 atom % D, min 98% Chemical Purity, 4-Chlorobenzyl cyanide-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 25 mg, 10 mg, 5 mg.
2-(4-chloro-2,3,5,6-tetradeuteriophenyl)acetonitrile (CAS 1219804-00-8) is a chemical compound with the molecular formula C8H6ClN and a molecular weight of 155.62 g/mol. IUPAC name: 2-(4-chloro-2,3,5,6-tetradeuteriophenyl)acetonitrile. InChIKey: IVYMIRMKXZAHRV-RHQRLBAQSA-N.
| Molecular formula | C8H6ClN |
|---|---|
| Molecular weight | 155.62 g/mol |
| IUPAC name | 2-(4-chloro-2,3,5,6-tetradeuteriophenyl)acetonitrile |
| InChIKey | IVYMIRMKXZAHRV-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CC#N)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)