CAS 1219804-24-6 appears in our catalog under these names: 4-Morpholine-d8-carbonyl Chloride, 98 atom % D, min 98% Chemical Purity, Morpholine-4-carbonyl-d8 (chloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, Get quote.
2,2,3,3,5,5,6,6-octadeuteriomorpholine-4-carbonyl chloride (CAS 1219804-24-6) is a chemical compound with the molecular formula C5H8ClNO2 and a molecular weight of 157.62 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuteriomorpholine-4-carbonyl chloride. InChIKey: XMWFMEYDRNJSOO-SVYQBANQSA-N.
| Molecular formula | C5H8ClNO2 |
|---|---|
| Molecular weight | 157.62 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuteriomorpholine-4-carbonyl chloride |
| InChIKey | XMWFMEYDRNJSOO-SVYQBANQSA-N |
| SMILES | [2H]C1(C(OC(C(N1C(=O)Cl)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)