Products 1219805-38-5
CAS 1219805-38-5 is the registry number for 2,4-Dimethyl-d6-aniline HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
2,4-bis(trideuteriomethyl)aniline;hydrochloride (CAS 1219805-38-5) is a chemical compound with the molecular formula C8H12ClN and a molecular weight of 163.68 g/mol. IUPAC name: 2,4-bis(trideuteriomethyl)aniline;hydrochloride. InChIKey: HFXISSJBRAPVLG-TXHXQZCNSA-N.
| Molecular formula | C8H12ClN |
|---|---|
| Molecular weight | 163.68 g/mol |
| IUPAC name | 2,4-bis(trideuteriomethyl)aniline;hydrochloride |
| InChIKey | HFXISSJBRAPVLG-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=C(C=C1)N)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)