Products 1219805-77-2
CAS 1219805-77-2 is the registry number for 4,4'-Dichlorobiphenyl-d8, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,01g.
1-chloro-4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2,3,5,6-tetradeuteriobenzene (CAS 1219805-77-2) is a chemical compound with the molecular formula C12H8Cl2 and a molecular weight of 231.14 g/mol. IUPAC name: 1-chloro-4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2,3,5,6-tetradeuteriobenzene. InChIKey: YTBRNEUEFCNVHC-PGRXLJNUSA-N.
| Molecular formula | C12H8Cl2 |
|---|---|
| Molecular weight | 231.14 g/mol |
| IUPAC name | 1-chloro-4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2,3,5,6-tetradeuteriobenzene |
| InChIKey | YTBRNEUEFCNVHC-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)