CAS 1219805-94-3 is the registry number for 2-Chloro-N,N-diethylethyl-d4-amine HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine;hydrochloride (CAS 1219805-94-3) is a chemical compound with the molecular formula C6H15Cl2N and a molecular weight of 176.12 g/mol. IUPAC name: 2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine;hydrochloride. InChIKey: RAGSWDIQBBZLLL-NXMSQKFDSA-N.
| Molecular formula | C6H15Cl2N |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | 2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine;hydrochloride |
| InChIKey | RAGSWDIQBBZLLL-NXMSQKFDSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)N(CC)CC.Cl |
Computed by PubChem (NCBI)