Products 1219805-94-3

CAS 1219805-94-3 is the registry number for 2-Chloro-N,N-diethylethyl-d4-amine HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine;hydrochloride (CAS 1219805-94-3) is a chemical compound with the molecular formula C6H15Cl2N and a molecular weight of 176.12 g/mol. IUPAC name: 2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine;hydrochloride. InChIKey: RAGSWDIQBBZLLL-NXMSQKFDSA-N.

Identity
Molecular formulaC6H15Cl2N
Molecular weight176.12 g/mol
IUPAC name2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine;hydrochloride
InChIKeyRAGSWDIQBBZLLL-NXMSQKFDSA-N
SMILES[2H]C([2H])(C([2H])([2H])Cl)N(CC)CC.Cl

Computed by PubChem (NCBI)