Products 1936-95-4

CAS 1936-95-4 appears in our catalog under these names: 3-Chloro-N,N,N-trimethylpropan-1-aminium chloride, 95%, 95%, (3-Chloropropyl)-trimethylammonium chloride, 95%, (3–Chloropropyl)–trimethylammonium chloride, (3-Chloropropyl)-trimethylammonium chloride, 3-Chloro-N,N,N-trimethylpropan-1-aminium chloride 95%. Offered by: Chemat, Combi-blocks, Fluorochem, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 2g.

Structural formula: {0} (CAS {1})

3-chloropropyl(trimethyl)azanium chloride (CAS 1936-95-4) is a chemical compound with the molecular formula C6H15Cl2N and a molecular weight of 172.09 g/mol. IUPAC name: 3-chloropropyl(trimethyl)azanium chloride. InChIKey: SCHZETOYDJAZMO-UHFFFAOYSA-M.

Identity
Molecular formulaC6H15Cl2N
Molecular weight172.09 g/mol
IUPAC name3-chloropropyl(trimethyl)azanium chloride
InChIKeySCHZETOYDJAZMO-UHFFFAOYSA-M
SMILESC[N+](C)(C)CCCCl.[Cl-]

Computed by PubChem (NCBI)