Products 1329614-05-2
CAS 1329614-05-2 is the registry number for 3-Dimethylamino-2-methylpropyl-d6 Chloride Hydrochloride. Offered by: TRC. Available pack sizes: 50mg, 5mg.
3-chloro-2-methyl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1329614-05-2) is a chemical compound with the molecular formula C6H15Cl2N and a molecular weight of 178.13 g/mol. IUPAC name: 3-chloro-2-methyl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: SOMIBONUMGNAEP-HVTBMTIBSA-N.
| Molecular formula | C6H15Cl2N |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 3-chloro-2-methyl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | SOMIBONUMGNAEP-HVTBMTIBSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C)CCl)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)