Products 1219806-03-7
CAS 1219806-03-7 appears in our catalog under these names: 2-(ethoxycarbonyl)benzoic-3,4,5,6-d4 acid, Monoethyl Phthalate-d4, >95% (HPLC), mono-Ethyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Monoethyl phthalate–d4, Monoethyl phthalate-d4, 98.36%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 50mg, 5mg, 0,1g, 0,05g, 1mg, 10mg, 10 mg.
2,3,4,5-tetradeuterio-6-ethoxycarbonylbenzoic acid (CAS 1219806-03-7) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 198.21 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-ethoxycarbonylbenzoic acid. InChIKey: YWWHKOHZGJFMIE-LNFUJOGGSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-ethoxycarbonylbenzoic acid |
| InChIKey | YWWHKOHZGJFMIE-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC)[2H])[2H] |
Computed by PubChem (NCBI)