CAS 1219806-46-8 appears in our catalog under these names: N-trans-Cinnamoylglycine-2,2-d2, 99 atom % D, min 98% Chemical Purity, Cinnamoylglycine-d2, 99.40%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg, 5 mg.
2,2-dideuterio-2-[[(E)-3-phenylprop-2-enoyl]amino]acetic acid (CAS 1219806-46-8) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 207.22 g/mol. IUPAC name: 2,2-dideuterio-2-[[(E)-3-phenylprop-2-enoyl]amino]acetic acid. InChIKey: YAADMLWHGMUGQL-FYUBTOIZSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | 2,2-dideuterio-2-[[(E)-3-phenylprop-2-enoyl]amino]acetic acid |
| InChIKey | YAADMLWHGMUGQL-FYUBTOIZSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)/C=C/C1=CC=CC=C1 |
Computed by PubChem (NCBI)