Products 1219921-41-1
CAS 1219921-41-1 appears in our catalog under these names: 3,3,3-Trifluoro-2-((2,4,6-trimethylphenyl)methyl)propanoic acid, 95%, 3,3,3-Trifluoro-2-((2,4,6-trimethylphenyl)methyl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3,3-trifluoro-2-[(2,4,6-trimethylphenyl)methyl]propanoic acid (CAS 1219921-41-1) is a chemical compound with the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. IUPAC name: 3,3,3-trifluoro-2-[(2,4,6-trimethylphenyl)methyl]propanoic acid. InChIKey: VQOXLVKBGAJOGT-UHFFFAOYSA-N.
| Molecular formula | C13H15F3O2 |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-[(2,4,6-trimethylphenyl)methyl]propanoic acid |
| InChIKey | VQOXLVKBGAJOGT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC(C(=O)O)C(F)(F)F)C |
Computed by PubChem (NCBI)