Products 2228876-15-9
CAS 2228876-15-9 appears in our catalog under these names: (2，2–dimethyl–1–(4–(trifluoromethoxy)phenyl)cyclopropyl)methanol, {2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]cyclopropyl}methanol. Offered by: GLPBio, Chemat. Available pack sizes: 250mg.
[2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanol (CAS 2228876-15-9) is a chemical compound with the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. IUPAC name: [2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanol. InChIKey: NJCCWPMEBMEEPU-UHFFFAOYSA-N.
| Molecular formula | C13H15F3O2 |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | [2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanol |
| InChIKey | NJCCWPMEBMEEPU-UHFFFAOYSA-N |
| SMILES | CC1(CC1(CO)C2=CC=C(C=C2)OC(F)(F)F)C |
Computed by PubChem (NCBI)