CAS 204779-82-8 is the registry number for Neopentyl 4-(trifluoromethyl)benzoate, 95%. Offered by: AmBeed. Available pack sizes: 100mg.
2,2-dimethylpropyl 4-(trifluoromethyl)benzoate (CAS 204779-82-8) is a chemical compound with the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. IUPAC name: 2,2-dimethylpropyl 4-(trifluoromethyl)benzoate. InChIKey: MWLUXIMHLPCFRZ-UHFFFAOYSA-N.
| Molecular formula | C13H15F3O2 |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | 2,2-dimethylpropyl 4-(trifluoromethyl)benzoate |
| InChIKey | MWLUXIMHLPCFRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)