CAS 1220219-51-1 appears in our catalog under these names: 2-(2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetonitrile, 98%, 3-Cyanomethyl-4-fluorobenzeneboronic acid pinacol ester. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 50mg, 250mg.
2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (CAS 1220219-51-1) is a chemical compound with the molecular formula C14H17BFNO2 and a molecular weight of 261.10 g/mol. IUPAC name: 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile. InChIKey: CSDHDGHUGRKMNQ-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| InChIKey | CSDHDGHUGRKMNQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CC#N |
Computed by PubChem (NCBI)