CAS 122024-75-3 appears in our catalog under these names: 3–(3–(Benzyloxy)phenyl)acrylic acid, 3-(3-(Benzyloxy)phenyl)acrylic acid, 97%, (2E)-3-[3-(Benzyloxy)phenyl]acrylic acid, 98%, 3-(3-(Benzyloxy)Phenyl)Acrylic Acid, 97% (E), 97% (E), 3-benzyloxycinnamic acid, 97% (E). Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
(E)-3-(3-phenylmethoxyphenyl)prop-2-enoic acid (CAS 122024-75-3) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (E)-3-(3-phenylmethoxyphenyl)prop-2-enoic acid. InChIKey: OFMOWGZEBJKDCT-MDZDMXLPSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (E)-3-(3-phenylmethoxyphenyl)prop-2-enoic acid |
| InChIKey | OFMOWGZEBJKDCT-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)